C23H20O7 — CID 152747053
3-[3-[2-(carboxymethoxy)-4-(3-methylbuta-1,3-dienoxy)phenyl]-3-oxoprop-1-enyl]benzoic acid (PubChem CID 152747053) has the molecular formula C23H20O7 and a molecular weight of 408.41 g/mol. Its IUPAC name is 3-[3-[2-(carboxymethoxy)-4-(3-methylbuta-1,3-dienoxy)phenyl]-3-oxoprop-1-enyl]benzoic acid.
| Compound Name | 3-[3-[2-(carboxymethoxy)-4-(3-methylbuta-1,3-dienoxy)phenyl]-3-oxoprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 152747053 |
| Molecular Formula | C23H20O7 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 3-[3-[2-(carboxymethoxy)-4-(3-methylbuta-1,3-dienoxy)phenyl]-3-oxoprop-1-enyl]benzoic acid |
| SMILES | C=C(C)C=COc1ccc(C(=O)C=Cc2cccc(C(=O)O)c2)c(OCC(=O)O)c1 |
| InChI | InChI=1S/C23H20O7/c1-15(2)10-11-29-18-7-8-19(21(13-18)30-14-22(25)26)20(24)9-6-16-4-3-5-17(12-16)23(27)28/h3-13H,1,14H2,2H3,(H,25,26)(H,27,28) |
| InChIKey | XPZDJNYRQVZVIS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|