C15H15ClN4O — CID 152747629
[1-(7-chloroquinazolin-4-yl)-4-methoxycyclohexa-2,4-dien-1-yl]hydrazine (PubChem CID 152747629) has the molecular formula C15H15ClN4O and a molecular weight of 302.77 g/mol. Its IUPAC name is [1-(7-chloroquinazolin-4-yl)-4-methoxycyclohexa-2,4-dien-1-yl]hydrazine.
| Compound Name | [1-(7-chloroquinazolin-4-yl)-4-methoxycyclohexa-2,4-dien-1-yl]hydrazine |
|---|---|
| PubChem CID | 152747629 |
| Molecular Formula | C15H15ClN4O |
| Molecular Weight | 302.77 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | [1-(7-chloroquinazolin-4-yl)-4-methoxycyclohexa-2,4-dien-1-yl]hydrazine |
| SMILES | COC1=CCC(NN)(c2ncnc3cc(Cl)ccc23)C=C1 |
| InChI | InChI=1S/C15H15ClN4O/c1-21-11-4-6-15(20-17,7-5-11)14-12-3-2-10(16)8-13(12)18-9-19-14/h2-6,8-9,20H,7,17H2,1H3 |
| InChIKey | OXCKDZVJHZSKOE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.77 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|