C10H17N3O2S — CID 152750264
1-pyrrolidin-1-ylsulfonylcyclohexa-3,5-diene-1,2-diamine (PubChem CID 152750264) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is 1-pyrrolidin-1-ylsulfonylcyclohexa-3,5-diene-1,2-diamine.
| Compound Name | 1-pyrrolidin-1-ylsulfonylcyclohexa-3,5-diene-1,2-diamine |
|---|---|
| PubChem CID | 152750264 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 1-pyrrolidin-1-ylsulfonylcyclohexa-3,5-diene-1,2-diamine |
| SMILES | NC1C=CC=CC1(N)S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C10H17N3O2S/c11-9-5-1-2-6-10(9,12)16(14,15)13-7-3-4-8-13/h1-2,5-6,9H,3-4,7-8,11-12H2 |
| InChIKey | NMJDNTYIBBKATP-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |