C10H19N3O2S — CID 152748453
1,6-diamino-N,N-diethylcyclohexa-2,4-diene-1-sulfonamide (PubChem CID 152748453) has the molecular formula C10H19N3O2S and a molecular weight of 245.35 g/mol. Its IUPAC name is 1,6-diamino-N,N-diethylcyclohexa-2,4-diene-1-sulfonamide.
| Compound Name | 1,6-diamino-N,N-diethylcyclohexa-2,4-diene-1-sulfonamide |
|---|---|
| PubChem CID | 152748453 |
| Molecular Formula | C10H19N3O2S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 1,6-diamino-N,N-diethylcyclohexa-2,4-diene-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)C1(N)C=CC=CC1N |
| InChI | InChI=1S/C10H19N3O2S/c1-3-13(4-2)16(14,15)10(12)8-6-5-7-9(10)11/h5-9H,3-4,11-12H2,1-2H3 |
| InChIKey | NCQYNXFCHJHLQG-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |