C12H20N2 — CID 15275033
7-pyrrolidin-1-yl-1,2,3,5,8,8a-hexahydroindolizine (PubChem CID 15275033) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 7-pyrrolidin-1-yl-1,2,3,5,8,8a-hexahydroindolizine.
| Compound Name | 7-pyrrolidin-1-yl-1,2,3,5,8,8a-hexahydroindolizine |
|---|---|
| PubChem CID | 15275033 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 7-pyrrolidin-1-yl-1,2,3,5,8,8a-hexahydroindolizine |
| SMILES | C1=C(N2CCCC2)CC2CCCN2C1 |
| InChI | InChI=1S/C12H20N2/c1-2-7-13(6-1)12-5-9-14-8-3-4-11(14)10-12/h5,11H,1-4,6-10H2 |
| InChIKey | WHLDLQIDFNWICI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |