C11H14O — CID 152755323
2,5-diethyl-2H-cyclopenta[b]furan (PubChem CID 152755323) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is 2,5-diethyl-2H-cyclopenta[b]furan.
| Compound Name | 2,5-diethyl-2H-cyclopenta[b]furan |
|---|---|
| PubChem CID | 152755323 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 2,5-diethyl-2H-cyclopenta[b]furan |
| SMILES | CCC1=CC2=CC(CC)OC2=C1 |
| InChI | InChI=1S/C11H14O/c1-3-8-5-9-7-10(4-2)12-11(9)6-8/h5-7,10H,3-4H2,1-2H3 |
| InChIKey | SSBNJLVIKXZCKX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |