C24H20Cl2N2O2 — CID 152757457
3-(2-chlorophenyl)-2-[(4-chlorophenyl)iminomethyl]-3-hydroxy-N-(1-phenylethyl)prop-2-enamide (PubChem CID 152757457) has the molecular formula C24H20Cl2N2O2 and a molecular weight of 439.34 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-2-[(4-chlorophenyl)iminomethyl]-3-hydroxy-N-(1-phenylethyl)prop-2-enamide.
| Compound Name | 3-(2-chlorophenyl)-2-[(4-chlorophenyl)iminomethyl]-3-hydroxy-N-(1-phenylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 152757457 |
| Molecular Formula | C24H20Cl2N2O2 |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 3-(2-chlorophenyl)-2-[(4-chlorophenyl)iminomethyl]-3-hydroxy-N-(1-phenylethyl)prop-2-enamide |
| SMILES | CC(NC(=O)C(/C=N/c1ccc(Cl)cc1)=C(O)c1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C24H20Cl2N2O2/c1-16(17-7-3-2-4-8-17)28-24(30)21(15-27-19-13-11-18(25)12-14-19)23(29)20-9-5-6-10-22(20)26/h2-16,29H,1H3,(H,28,30)/b23-21?,27-15+ |
| InChIKey | JTPSHJNFJLZRPJ-CQLGOASCSA-N |
| XLogP | 6.54 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|