C19H14ClIN2O2 — CID 152757467
3-(2-chlorophenyl)-3-hydroxy-2-[(4-iodophenyl)iminomethyl]-N-prop-2-ynylprop-2-enamide (PubChem CID 152757467) has the molecular formula C19H14ClIN2O2 and a molecular weight of 464.69 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-3-hydroxy-2-[(4-iodophenyl)iminomethyl]-N-prop-2-ynylprop-2-enamide.
| Compound Name | 3-(2-chlorophenyl)-3-hydroxy-2-[(4-iodophenyl)iminomethyl]-N-prop-2-ynylprop-2-enamide |
|---|---|
| PubChem CID | 152757467 |
| Molecular Formula | C19H14ClIN2O2 |
| Molecular Weight | 464.69 g/mol |
| Exact Mass | 463.98 |
| IUPAC Name | 3-(2-chlorophenyl)-3-hydroxy-2-[(4-iodophenyl)iminomethyl]-N-prop-2-ynylprop-2-enamide |
| SMILES | C#CCNC(=O)C(/C=N/c1ccc(I)cc1)=C(O)c1ccccc1Cl |
| InChI | InChI=1S/C19H14ClIN2O2/c1-2-11-22-19(25)16(12-23-14-9-7-13(21)8-10-14)18(24)15-5-3-4-6-17(15)20/h1,3-10,12,24H,11H2,(H,22,25)/b18-16?,23-12+ |
| InChIKey | AILNJUGCDLGMHG-OPLYEPLDSA-N |
| XLogP | 4.37 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.69 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|