C14H11N3O2 — CID 152757521
2-cyano-N-(4-cyanophenyl)-3-hydroxy-4-methylpenta-2,4-dienamide (PubChem CID 152757521) has the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. Its IUPAC name is 2-cyano-N-(4-cyanophenyl)-3-hydroxy-4-methylpenta-2,4-dienamide.
| Compound Name | 2-cyano-N-(4-cyanophenyl)-3-hydroxy-4-methylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 152757521 |
| Molecular Formula | C14H11N3O2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2-cyano-N-(4-cyanophenyl)-3-hydroxy-4-methylpenta-2,4-dienamide |
| SMILES | C=C(C)C(O)=C(C#N)C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H11N3O2/c1-9(2)13(18)12(8-16)14(19)17-11-5-3-10(7-15)4-6-11/h3-6,18H,1H2,2H3,(H,17,19) |
| InChIKey | QMOSOTGPVQDNMS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|