C17H19N3O3 — CID 152757739
(4R,4aR,7S,7aR,12bS)-10-diazo-3-methyl-1,2,4,4a,7,7a,11,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol (PubChem CID 152757739) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is (4R,4aR,7S,7aR,12bS)-10-diazo-3-methyl-1,2,4,4a,7,7a,11,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol.
| Compound Name | (4R,4aR,7S,7aR,12bS)-10-diazo-3-methyl-1,2,4,4a,7,7a,11,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol |
|---|---|
| PubChem CID | 152757739 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | (4R,4aR,7S,7aR,12bS)-10-diazo-3-methyl-1,2,4,4a,7,7a,11,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol |
| SMILES | CN1CC[C@]23C4=C5CC(=[N+]=[N-])C(O)=C4O[C@H]2[C@@H](O)C=C[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C17H19N3O3/c1-20-5-4-17-9-2-3-12(21)16(17)23-15-13(17)8(7-11(9)20)6-10(19-18)14(15)22/h2-3,9,11-12,16,21-22H,4-7H2,1H3/t9-,11+,12-,16-,17-/m0/s1 |
| InChIKey | GHGXVTQSPGBXNJ-GLWLLPOHSA-N |
| XLogP | 1.17 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|