C17H20BrNO3 — CID 67292813
(4R,4aR,7S,7aR,12bS)-9-bromo-3-methyl-1,2,4,4a,7,7a,10,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol (PubChem CID 67292813) has the molecular formula C17H20BrNO3 and a molecular weight of 366.26 g/mol. Its IUPAC name is (4R,4aR,7S,7aR,12bS)-9-bromo-3-methyl-1,2,4,4a,7,7a,10,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol.
| Compound Name | (4R,4aR,7S,7aR,12bS)-9-bromo-3-methyl-1,2,4,4a,7,7a,10,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol |
|---|---|
| PubChem CID | 67292813 |
| Molecular Formula | C17H20BrNO3 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | (4R,4aR,7S,7aR,12bS)-9-bromo-3-methyl-1,2,4,4a,7,7a,10,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol |
| SMILES | CN1CC[C@]23C4=C5O[C@H]2[C@@H](O)C=C[C@H]3[C@H]1CC4=CCC5(O)Br |
| InChI | InChI=1S/C17H20BrNO3/c1-19-7-6-16-10-2-3-12(20)14(16)22-15-13(16)9(8-11(10)19)4-5-17(15,18)21/h2-4,10-12,14,20-21H,5-8H2,1H3/t10-,11+,12-,14-,16-,17?/m0/s1 |
| InChIKey | OGHHSEALZASTJX-BKDXDTBISA-N |
| XLogP | 1.69 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|