C44H39F2NO — CID 152763528
2-(2,3-difluorophenyl)-6-(3,6-diphenylcarbazol-9-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 152763528) has the molecular formula C44H39F2NO and a molecular weight of 635.80 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-6-(3,6-diphenylcarbazol-9-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol.
| Compound Name | 2-(2,3-difluorophenyl)-6-(3,6-diphenylcarbazol-9-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 152763528 |
| Molecular Formula | C44H39F2NO |
| Molecular Weight | 635.80 g/mol |
| Exact Mass | 635.30 |
| IUPAC Name | 2-(2,3-difluorophenyl)-6-(3,6-diphenylcarbazol-9-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | CC(C)(C)CC(C)(C)c1cc(-c2cccc(F)c2F)c(O)c(-n2c3ccc(-c4ccccc4)cc3c3cc(-c4ccccc4)ccc32)c1 |
| InChI | InChI=1S/C44H39F2NO/c1-43(2,3)27-44(4,5)32-25-36(33-17-12-18-37(45)41(33)46)42(48)40(26-32)47-38-21-19-30(28-13-8-6-9-14-28)23-34(38)35-24-31(20-22-39(35)47)29-15-10-7-11-16-29/h6-26,48H,27H2,1-5H3 |
| InChIKey | VJHKTDNTROTLOD-UHFFFAOYSA-N |
| XLogP | 12.48 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.80 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |