C28H30Cl2FN5O2 — CID 152764655
3-[2-[5-amino-6-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]phenyl]-4-pyrrolidin-1-ylpiperidine-1-carbaldehyde (PubChem CID 152764655) has the molecular formula C28H30Cl2FN5O2 and a molecular weight of 558.49 g/mol. Its IUPAC name is 3-[2-[5-amino-6-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]phenyl]-4-pyrrolidin-1-ylpiperidine-1-carbaldehyde.
| Compound Name | 3-[2-[5-amino-6-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]phenyl]-4-pyrrolidin-1-ylpiperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 152764655 |
| Molecular Formula | C28H30Cl2FN5O2 |
| Molecular Weight | 558.49 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | 3-[2-[5-amino-6-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]phenyl]-4-pyrrolidin-1-ylpiperidine-1-carbaldehyde |
| SMILES | CC(Oc1nc(-c2ccccc2C2CN(C=O)CCC2N2CCCC2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C28H30Cl2FN5O2/c1-17(25-21(29)8-9-22(31)26(25)30)38-28-27(32)33-14-23(34-28)19-7-3-2-6-18(19)20-15-35(16-37)13-10-24(20)36-11-4-5-12-36/h2-3,6-9,14,16-17,20,24H,4-5,10-13,15H2,1H3,(H2,32,33) |
| InChIKey | ATTQDVVNQUGUIU-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.49 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|