C7H10N2O3 — CID 15276926
5-(2-methoxyethyl)-1H-pyrimidine-2,4-dione (PubChem CID 15276926) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is 5-(2-methoxyethyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(2-methoxyethyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 15276926 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 5-(2-methoxyethyl)-1H-pyrimidine-2,4-dione |
| SMILES | COCCc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C7H10N2O3/c1-12-3-2-5-4-8-7(11)9-6(5)10/h4H,2-3H2,1H3,(H2,8,9,10,11) |
| InChIKey | QDSSSYJCTRKILR-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |