C27H21ClN6 — CID 152769784
4-[2-[7-chloro-3-[(phenylhydrazinylidene)methyl]-1H-pyrrolo[3,2-c]quinolin-2-yl]ethylamino]benzonitrile (PubChem CID 152769784) has the molecular formula C27H21ClN6 and a molecular weight of 464.96 g/mol. Its IUPAC name is 4-[2-[7-chloro-3-[(phenylhydrazinylidene)methyl]-1H-pyrrolo[3,2-c]quinolin-2-yl]ethylamino]benzonitrile.
| Compound Name | 4-[2-[7-chloro-3-[(phenylhydrazinylidene)methyl]-1H-pyrrolo[3,2-c]quinolin-2-yl]ethylamino]benzonitrile |
|---|---|
| PubChem CID | 152769784 |
| Molecular Formula | C27H21ClN6 |
| Molecular Weight | 464.96 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 4-[2-[7-chloro-3-[(phenylhydrazinylidene)methyl]-1H-pyrrolo[3,2-c]quinolin-2-yl]ethylamino]benzonitrile |
| SMILES | N#Cc1ccc(NCCc2[nH]c3c(cnc4cc(Cl)ccc43)c2C=NNc2ccccc2)cc1 |
| InChI | InChI=1S/C27H21ClN6/c28-19-8-11-22-26(14-19)31-16-24-23(17-32-34-21-4-2-1-3-5-21)25(33-27(22)24)12-13-30-20-9-6-18(15-29)7-10-20/h1-11,14,16-17,30,33-34H,12-13H2 |
| InChIKey | JAXYLFYAENXUTN-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.96 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|