C20H23F3N6O — CID 152770863
4-[[4-[2-(diethylamino)ethyl]-5-methyl-3-(trifluoromethyl)-1H-pyrrol-2-yl]methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one (PubChem CID 152770863) has the molecular formula C20H23F3N6O and a molecular weight of 420.44 g/mol. Its IUPAC name is 4-[[4-[2-(diethylamino)ethyl]-5-methyl-3-(trifluoromethyl)-1H-pyrrol-2-yl]methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one.
| Compound Name | 4-[[4-[2-(diethylamino)ethyl]-5-methyl-3-(trifluoromethyl)-1H-pyrrol-2-yl]methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one |
|---|---|
| PubChem CID | 152770863 |
| Molecular Formula | C20H23F3N6O |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 4-[[4-[2-(diethylamino)ethyl]-5-methyl-3-(trifluoromethyl)-1H-pyrrol-2-yl]methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one |
| SMILES | CCN(CC)CCc1c(C)[nH]c(C=C2C(=O)NN=C2c2cnccn2)c1C(F)(F)F |
| InChI | InChI=1S/C20H23F3N6O/c1-4-29(5-2)9-6-13-12(3)26-15(17(13)20(21,22)23)10-14-18(27-28-19(14)30)16-11-24-7-8-25-16/h7-8,10-11,26H,4-6,9H2,1-3H3,(H,28,30) |
| InChIKey | NUKFFWXYFRTDMP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|