C22H23N7O — CID 152770877
4-[[4-[2-(ethylamino)ethyl]-5-methyl-3-pyridin-2-yl-1H-pyrrol-2-yl]methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one (PubChem CID 152770877) has the molecular formula C22H23N7O and a molecular weight of 401.47 g/mol. Its IUPAC name is 4-[[4-[2-(ethylamino)ethyl]-5-methyl-3-pyridin-2-yl-1H-pyrrol-2-yl]methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one.
| Compound Name | 4-[[4-[2-(ethylamino)ethyl]-5-methyl-3-pyridin-2-yl-1H-pyrrol-2-yl]methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one |
|---|---|
| PubChem CID | 152770877 |
| Molecular Formula | C22H23N7O |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 4-[[4-[2-(ethylamino)ethyl]-5-methyl-3-pyridin-2-yl-1H-pyrrol-2-yl]methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one |
| SMILES | CCNCCc1c(C)[nH]c(C=C2C(=O)NN=C2c2cnccn2)c1-c1ccccn1 |
| InChI | InChI=1S/C22H23N7O/c1-3-23-9-7-15-14(2)27-18(20(15)17-6-4-5-8-25-17)12-16-21(28-29-22(16)30)19-13-24-10-11-26-19/h4-6,8,10-13,23,27H,3,7,9H2,1-2H3,(H,29,30) |
| InChIKey | LIUIFWUGCXCTAD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|