C21H20N8O — CID 152770848
4-[[4-[(cyclopropylamino)methyl]-5-methyl-3-pyrimidin-2-yl-1H-pyrrol-2-yl]methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one (PubChem CID 152770848) has the molecular formula C21H20N8O and a molecular weight of 400.45 g/mol. Its IUPAC name is 4-[[4-[(cyclopropylamino)methyl]-5-methyl-3-pyrimidin-2-yl-1H-pyrrol-2-yl]methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one.
| Compound Name | 4-[[4-[(cyclopropylamino)methyl]-5-methyl-3-pyrimidin-2-yl-1H-pyrrol-2-yl]methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one |
|---|---|
| PubChem CID | 152770848 |
| Molecular Formula | C21H20N8O |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 4-[[4-[(cyclopropylamino)methyl]-5-methyl-3-pyrimidin-2-yl-1H-pyrrol-2-yl]methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one |
| SMILES | Cc1[nH]c(C=C2C(=O)NN=C2c2cnccn2)c(-c2ncccn2)c1CNC1CC1 |
| InChI | InChI=1S/C21H20N8O/c1-12-15(10-26-13-3-4-13)18(20-24-5-2-6-25-20)16(27-12)9-14-19(28-29-21(14)30)17-11-22-7-8-23-17/h2,5-9,11,13,26-27H,3-4,10H2,1H3,(H,29,30) |
| InChIKey | RZZLSBKSLJJMNI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|