C7H12N2O — CID 152779640
N-[cyclohexa-1,5-dien-1-yl(methyl)amino]hydroxylamine (PubChem CID 152779640) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is N-[cyclohexa-1,5-dien-1-yl(methyl)amino]hydroxylamine.
| Compound Name | N-[cyclohexa-1,5-dien-1-yl(methyl)amino]hydroxylamine |
|---|---|
| PubChem CID | 152779640 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | N-[cyclohexa-1,5-dien-1-yl(methyl)amino]hydroxylamine |
| SMILES | CN(NO)C1=CCCC=C1 |
| InChI | InChI=1S/C7H12N2O/c1-9(8-10)7-5-3-2-4-6-7/h3,5-6,8,10H,2,4H2,1H3 |
| InChIKey | MYRRJDDUSANZOH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|