C10H14N2 — CID 161264347
1-methyl-1-(3-propa-1,2-dienylcyclohexa-1,5-dien-1-yl)hydrazine (PubChem CID 161264347) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 1-methyl-1-(3-propa-1,2-dienylcyclohexa-1,5-dien-1-yl)hydrazine.
| Compound Name | 1-methyl-1-(3-propa-1,2-dienylcyclohexa-1,5-dien-1-yl)hydrazine |
|---|---|
| PubChem CID | 161264347 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 1-methyl-1-(3-propa-1,2-dienylcyclohexa-1,5-dien-1-yl)hydrazine |
| SMILES | C=C=CC1C=C(N(C)N)C=CC1 |
| InChI | InChI=1S/C10H14N2/c1-3-5-9-6-4-7-10(8-9)12(2)11/h4-5,7-9H,1,6,11H2,2H3 |
| InChIKey | VCYZSFZETCFSRW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|