C12H21F2N3O4Si — CID 152781328
6-amino-3-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-trimethylsilyl-1H-pyrimidin-2-one (PubChem CID 152781328) has the molecular formula C12H21F2N3O4Si and a molecular weight of 337.40 g/mol. Its IUPAC name is 6-amino-3-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-trimethylsilyl-1H-pyrimidin-2-one.
| Compound Name | 6-amino-3-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-trimethylsilyl-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 152781328 |
| Molecular Formula | C12H21F2N3O4Si |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 6-amino-3-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-trimethylsilyl-1H-pyrimidin-2-one |
| SMILES | C[Si](C)(C)C1(N)C=CN([C@@H]2O[C@H](CO)[C@@H](O)C2(F)F)C(=O)N1 |
| InChI | InChI=1S/C12H21F2N3O4Si/c1-22(2,3)11(15)4-5-17(10(20)16-11)9-12(13,14)8(19)7(6-18)21-9/h4-5,7-9,18-19H,6,15H2,1-3H3,(H,16,20)/t7-,8-,9-,11?/m1/s1 |
| InChIKey | OYLZBQWGDMWJDG-YIPHXTPMSA-N |
| XLogP | -0.23 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|