C9H11F2N2O5 — CID 71434085
2'-Deoxy-2',2'-difluorouridine-13C,15N2 (PubChem CID 71434085) has the molecular formula C9H11F2N2O5 and a molecular weight of 268.17 g/mol.
| Compound Name | 2'-Deoxy-2',2'-difluorouridine-13C,15N2 |
|---|---|
| PubChem CID | 71434085 |
| Molecular Formula | C9H11F2N2O5 |
| Molecular Weight | 268.17 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | — |
| SMILES | O=C1CC[15N]([C@@H]2O[C@H](CO)[C@@H](O)C2(F)F)[13C](=O)[15N]1 |
| InChI | InChI=1S/C9H11F2N2O5/c10-9(11)6(16)4(3-14)18-7(9)13-2-1-5(15)12-8(13)17/h4,6-7,14,16H,1-3H2/t4-,6-,7-/m1/s1/i8+1,12+1,13+1 |
| InChIKey | WUIVKAJAZTUFJH-TZHUGDOOSA-N |
| XLogP | -1.34 |
| TPSA | 101.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.17 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |