C36H28ClFN6O6 — CID 152783869
4-[2-[2-[(E)-3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoyl]-4,4-dimethyl-5-(4-nitrophenyl)-1,3-dihydroisoquinolin-1-yl]-2-oxoethyl]benzoic acid (PubChem CID 152783869) has the molecular formula C36H28ClFN6O6 and a molecular weight of 695.11 g/mol. Its IUPAC name is 4-[2-[2-[(E)-3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoyl]-4,4-dimethyl-5-(4-nitrophenyl)-1,3-dihydroisoquinolin-1-yl]-2-oxoethyl]benzoic acid.
| Compound Name | 4-[2-[2-[(E)-3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoyl]-4,4-dimethyl-5-(4-nitrophenyl)-1,3-dihydroisoquinolin-1-yl]-2-oxoethyl]benzoic acid |
|---|---|
| PubChem CID | 152783869 |
| Molecular Formula | C36H28ClFN6O6 |
| Molecular Weight | 695.11 g/mol |
| Exact Mass | 694.17 |
| IUPAC Name | 4-[2-[2-[(E)-3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoyl]-4,4-dimethyl-5-(4-nitrophenyl)-1,3-dihydroisoquinolin-1-yl]-2-oxoethyl]benzoic acid |
| SMILES | CC1(C)CN(C(=O)/C=C/c2c(-n3cnnn3)ccc(Cl)c2F)C(C(=O)Cc2ccc(C(=O)O)cc2)c2cccc(-c3ccc([N+](=O)[O-])cc3)c21 |
| InChI | InChI=1S/C36H28ClFN6O6/c1-36(2)19-42(31(46)17-14-26-29(43-20-39-40-41-43)16-15-28(37)33(26)38)34(30(45)18-21-6-8-23(9-7-21)35(47)48)27-5-3-4-25(32(27)36)22-10-12-24(13-11-22)44(49)50/h3-17,20,34H,18-19H2,1-2H3,(H,47,48)/b17-14+ |
| InChIKey | RUIWKSMNLRLZFL-SAPNQHFASA-N |
| XLogP | 6.41 |
| TPSA | 161.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.11 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|