C17H13N5O2 — CID 152798051
5-[(2-anilinopyrimidin-4-yl)amino]-3H-1,3-benzoxazol-2-one (PubChem CID 152798051) has the molecular formula C17H13N5O2 and a molecular weight of 319.32 g/mol. Its IUPAC name is 5-[(2-anilinopyrimidin-4-yl)amino]-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-[(2-anilinopyrimidin-4-yl)amino]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 152798051 |
| Molecular Formula | C17H13N5O2 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 5-[(2-anilinopyrimidin-4-yl)amino]-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2cc(Nc3ccnc(Nc4ccccc4)n3)ccc2o1 |
| InChI | InChI=1S/C17H13N5O2/c23-17-21-13-10-12(6-7-14(13)24-17)19-15-8-9-18-16(22-15)20-11-4-2-1-3-5-11/h1-10H,(H,21,23)(H2,18,19,20,22) |
| InChIKey | BFZBCKQMWWXCAT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |