C30H31N3O3 — CID 152800379
(2R)-1-[(2S)-2-[2-[2-(4-aminophenyl)-1-benzofuran-5-yl]acetyl]pyrrolidin-1-yl]-2-(dimethylamino)-2-phenylethanone (PubChem CID 152800379) has the molecular formula C30H31N3O3 and a molecular weight of 481.60 g/mol. Its IUPAC name is (2R)-1-[(2S)-2-[2-[2-(4-aminophenyl)-1-benzofuran-5-yl]acetyl]pyrrolidin-1-yl]-2-(dimethylamino)-2-phenylethanone.
| Compound Name | (2R)-1-[(2S)-2-[2-[2-(4-aminophenyl)-1-benzofuran-5-yl]acetyl]pyrrolidin-1-yl]-2-(dimethylamino)-2-phenylethanone |
|---|---|
| PubChem CID | 152800379 |
| Molecular Formula | C30H31N3O3 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | (2R)-1-[(2S)-2-[2-[2-(4-aminophenyl)-1-benzofuran-5-yl]acetyl]pyrrolidin-1-yl]-2-(dimethylamino)-2-phenylethanone |
| SMILES | CN(C)[C@@H](C(=O)N1CCC[C@H]1C(=O)Cc1ccc2oc(-c3ccc(N)cc3)cc2c1)c1ccccc1 |
| InChI | InChI=1S/C30H31N3O3/c1-32(2)29(22-7-4-3-5-8-22)30(35)33-16-6-9-25(33)26(34)18-20-10-15-27-23(17-20)19-28(36-27)21-11-13-24(31)14-12-21/h3-5,7-8,10-15,17,19,25,29H,6,9,16,18,31H2,1-2H3/t25-,29+/m0/s1 |
| InChIKey | SNGMRFMQBXBIEE-ABYGYWHVSA-N |
| XLogP | 5.09 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|