C29H31NO5 — CID 15280240
tert-butyl (3R,5S)-3-hydroxy-2-oxo-5-(trityloxymethyl)pyrrolidine-1-carboxylate (PubChem CID 15280240) has the molecular formula C29H31NO5 and a molecular weight of 473.57 g/mol. Its IUPAC name is tert-butyl (3R,5S)-3-hydroxy-2-oxo-5-(trityloxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R,5S)-3-hydroxy-2-oxo-5-(trityloxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 15280240 |
| Molecular Formula | C29H31NO5 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | tert-butyl (3R,5S)-3-hydroxy-2-oxo-5-(trityloxymethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@H](O)C[C@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H31NO5/c1-28(2,3)35-27(33)30-24(19-25(31)26(30)32)20-34-29(21-13-7-4-8-14-21,22-15-9-5-10-16-22)23-17-11-6-12-18-23/h4-18,24-25,31H,19-20H2,1-3H3/t24-,25+/m0/s1 |
| InChIKey | ZPIKMMPTAIUMLY-LOSJGSFVSA-N |
| XLogP | 4.89 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|