C28H28N2O3 — CID 152804958
4-[3-[[(E)-but-2-enoyl]-methylamino]phenyl]-7-(2-hydroxypropan-2-yl)-9H-fluorene-1-carboxamide (PubChem CID 152804958) has the molecular formula C28H28N2O3 and a molecular weight of 440.54 g/mol. Its IUPAC name is 4-[3-[[(E)-but-2-enoyl]-methylamino]phenyl]-7-(2-hydroxypropan-2-yl)-9H-fluorene-1-carboxamide.
| Compound Name | 4-[3-[[(E)-but-2-enoyl]-methylamino]phenyl]-7-(2-hydroxypropan-2-yl)-9H-fluorene-1-carboxamide |
|---|---|
| PubChem CID | 152804958 |
| Molecular Formula | C28H28N2O3 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 4-[3-[[(E)-but-2-enoyl]-methylamino]phenyl]-7-(2-hydroxypropan-2-yl)-9H-fluorene-1-carboxamide |
| SMILES | C/C=C/C(=O)N(C)c1cccc(-c2ccc(C(N)=O)c3c2-c2ccc(C(C)(C)O)cc2C3)c1 |
| InChI | InChI=1S/C28H28N2O3/c1-5-7-25(31)30(4)20-9-6-8-17(15-20)21-12-13-23(27(29)32)24-16-18-14-19(28(2,3)33)10-11-22(18)26(21)24/h5-15,33H,16H2,1-4H3,(H2,29,32)/b7-5+ |
| InChIKey | SPCTWENPZQQROO-FNORWQNLSA-N |
| XLogP | 4.79 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|