C22H23NO3S — CID 147501763
7-[3-(2-ethenylsulfonylethyl)phenyl]-1,2-dimethyl-3H-indene-4-carboxamide (PubChem CID 147501763) has the molecular formula C22H23NO3S and a molecular weight of 381.50 g/mol. Its IUPAC name is 7-[3-(2-ethenylsulfonylethyl)phenyl]-1,2-dimethyl-3H-indene-4-carboxamide.
| Compound Name | 7-[3-(2-ethenylsulfonylethyl)phenyl]-1,2-dimethyl-3H-indene-4-carboxamide |
|---|---|
| PubChem CID | 147501763 |
| Molecular Formula | C22H23NO3S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 7-[3-(2-ethenylsulfonylethyl)phenyl]-1,2-dimethyl-3H-indene-4-carboxamide |
| SMILES | C=CS(=O)(=O)CCc1cccc(-c2ccc(C(N)=O)c3c2C(C)=C(C)C3)c1 |
| InChI | InChI=1S/C22H23NO3S/c1-4-27(25,26)11-10-16-6-5-7-17(13-16)18-8-9-19(22(23)24)20-12-14(2)15(3)21(18)20/h4-9,13H,1,10-12H2,2-3H3,(H2,23,24) |
| InChIKey | FHNYNOWCPLEDLC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |