C38H37N5O5 — CID 159286254
4-(3-aminophenyl)-2-(2-hydroxyethyl)-1H-indole-7-carboxamide;2-(2-hydroxyethyl)-4-[3-(2-oxobut-3-enyl)phenyl]-1H-indole-7-carboxamide (PubChem CID 159286254) has the molecular formula C38H37N5O5 and a molecular weight of 643.74 g/mol. Its IUPAC name is 4-(3-aminophenyl)-2-(2-hydroxyethyl)-1H-indole-7-carboxamide;2-(2-hydroxyethyl)-4-[3-(2-oxobut-3-enyl)phenyl]-1H-indole-7-carboxamide.
| Compound Name | 4-(3-aminophenyl)-2-(2-hydroxyethyl)-1H-indole-7-carboxamide;2-(2-hydroxyethyl)-4-[3-(2-oxobut-3-enyl)phenyl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 159286254 |
| Molecular Formula | C38H37N5O5 |
| Molecular Weight | 643.74 g/mol |
| Exact Mass | 643.28 |
| IUPAC Name | 4-(3-aminophenyl)-2-(2-hydroxyethyl)-1H-indole-7-carboxamide;2-(2-hydroxyethyl)-4-[3-(2-oxobut-3-enyl)phenyl]-1H-indole-7-carboxamide |
| SMILES | C=CC(=O)Cc1cccc(-c2ccc(C(N)=O)c3[nH]c(CCO)cc23)c1.NC(=O)c1ccc(-c2cccc(N)c2)c2cc(CCO)[nH]c12 |
| InChI | InChI=1S/C21H20N2O3.C17H17N3O2/c1-2-16(25)11-13-4-3-5-14(10-13)17-6-7-18(21(22)26)20-19(17)12-15(23-20)8-9-24;18-11-3-1-2-10(8-11)13-4-5-14(17(19)22)16-15(13)9-12(20-16)6-7-21/h2-7,10,12,23-24H,1,8-9,11H2,(H2,22,26);1-5,8-9,20-21H,6-7,18H2,(H2,19,22) |
| InChIKey | KZNWLESZGAJALX-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 201.31 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.74 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|