C23H24N2O3 — CID 147575132
2-(2-ethoxyethyl)-4-[3-(2-oxobut-3-enyl)phenyl]-1H-indole-7-carboxamide (PubChem CID 147575132) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-(2-ethoxyethyl)-4-[3-(2-oxobut-3-enyl)phenyl]-1H-indole-7-carboxamide.
| Compound Name | 2-(2-ethoxyethyl)-4-[3-(2-oxobut-3-enyl)phenyl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 147575132 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 2-(2-ethoxyethyl)-4-[3-(2-oxobut-3-enyl)phenyl]-1H-indole-7-carboxamide |
| SMILES | C=CC(=O)Cc1cccc(-c2ccc(C(N)=O)c3[nH]c(CCOCC)cc23)c1 |
| InChI | InChI=1S/C23H24N2O3/c1-3-18(26)13-15-6-5-7-16(12-15)19-8-9-20(23(24)27)22-21(19)14-17(25-22)10-11-28-4-2/h3,5-9,12,14,25H,1,4,10-11,13H2,2H3,(H2,24,27) |
| InChIKey | FVIACFVMRPRUET-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|