C12H24N2 — CID 152807256
(3aS,6aR)-5-tert-butyl-2,3a-dimethyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 152807256) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is (3aS,6aR)-5-tert-butyl-2,3a-dimethyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | (3aS,6aR)-5-tert-butyl-2,3a-dimethyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 152807256 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | (3aS,6aR)-5-tert-butyl-2,3a-dimethyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | CN1C[C@@H]2CN(C(C)(C)C)C[C@]2(C)C1 |
| InChI | InChI=1S/C12H24N2/c1-11(2,3)14-7-10-6-13(5)8-12(10,4)9-14/h10H,6-9H2,1-5H3/t10-,12+/m1/s1 |
| InChIKey | SPSUONYKJXSGSE-PWSUYJOCSA-N |
| XLogP | 1.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |