C14H29N — CID 170668415
1,4-ditert-butyl-3,3-dimethylpyrrolidine (PubChem CID 170668415) has the molecular formula C14H29N and a molecular weight of 211.39 g/mol. Its IUPAC name is 1,4-ditert-butyl-3,3-dimethylpyrrolidine.
| Compound Name | 1,4-ditert-butyl-3,3-dimethylpyrrolidine |
|---|---|
| PubChem CID | 170668415 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | 1,4-ditert-butyl-3,3-dimethylpyrrolidine |
| SMILES | CC(C)(C)C1CN(C(C)(C)C)CC1(C)C |
| InChI | InChI=1S/C14H29N/c1-12(2,3)11-9-15(13(4,5)6)10-14(11,7)8/h11H,9-10H2,1-8H3 |
| InChIKey | ZASPZOGNQLHRMM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |