C13H23F4N — CID 177072830
1,4-ditert-butyl-3,3,5,5-tetrafluoropiperidine (PubChem CID 177072830) has the molecular formula C13H23F4N and a molecular weight of 269.33 g/mol. Its IUPAC name is 1,4-ditert-butyl-3,3,5,5-tetrafluoropiperidine.
| Compound Name | 1,4-ditert-butyl-3,3,5,5-tetrafluoropiperidine |
|---|---|
| PubChem CID | 177072830 |
| Molecular Formula | C13H23F4N |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 1,4-ditert-butyl-3,3,5,5-tetrafluoropiperidine |
| SMILES | CC(C)(C)C1C(F)(F)CN(C(C)(C)C)CC1(F)F |
| InChI | InChI=1S/C13H23F4N/c1-10(2,3)9-12(14,15)7-18(11(4,5)6)8-13(9,16)17/h9H,7-8H2,1-6H3 |
| InChIKey | DXFAZVJLUDHWNX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |