C17H32F2N2 — CID 135275105
1-tert-butyl-3,3-difluoro-4-(2-pyrrolidin-1-ylpropyl)azepane (PubChem CID 135275105) has the molecular formula C17H32F2N2 and a molecular weight of 302.45 g/mol. Its IUPAC name is 1-tert-butyl-3,3-difluoro-4-(2-pyrrolidin-1-ylpropyl)azepane.
| Compound Name | 1-tert-butyl-3,3-difluoro-4-(2-pyrrolidin-1-ylpropyl)azepane |
|---|---|
| PubChem CID | 135275105 |
| Molecular Formula | C17H32F2N2 |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | 1-tert-butyl-3,3-difluoro-4-(2-pyrrolidin-1-ylpropyl)azepane |
| SMILES | CC(CC1CCCN(C(C)(C)C)CC1(F)F)N1CCCC1 |
| InChI | InChI=1S/C17H32F2N2/c1-14(20-9-5-6-10-20)12-15-8-7-11-21(16(2,3)4)13-17(15,18)19/h14-15H,5-13H2,1-4H3 |
| InChIKey | FQNFDRLFGDCCSB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |