C16H32F2N2 — CID 157050293
1-tert-butyl-3,3-difluoropyrrolidine;1-tert-butylpyrrolidine (PubChem CID 157050293) has the molecular formula C16H32F2N2 and a molecular weight of 290.44 g/mol. Its IUPAC name is 1-tert-butyl-3,3-difluoropyrrolidine;1-tert-butylpyrrolidine.
| Compound Name | 1-tert-butyl-3,3-difluoropyrrolidine;1-tert-butylpyrrolidine |
|---|---|
| PubChem CID | 157050293 |
| Molecular Formula | C16H32F2N2 |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | 1-tert-butyl-3,3-difluoropyrrolidine;1-tert-butylpyrrolidine |
| SMILES | CC(C)(C)N1CCC(F)(F)C1.CC(C)(C)N1CCCC1 |
| InChI | InChI=1S/C8H15F2N.C8H17N/c1-7(2,3)11-5-4-8(9,10)6-11;1-8(2,3)9-6-4-5-7-9/h4-6H2,1-3H3;4-7H2,1-3H3 |
| InChIKey | AACTUOKSDQYNJQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |