C11H21F2N — CID 176933645
(4S)-1-butan-2-yl-4-ethyl-3,3-difluoropiperidine (PubChem CID 176933645) has the molecular formula C11H21F2N and a molecular weight of 205.29 g/mol. Its IUPAC name is (4S)-1-butan-2-yl-4-ethyl-3,3-difluoropiperidine.
| Compound Name | (4S)-1-butan-2-yl-4-ethyl-3,3-difluoropiperidine |
|---|---|
| PubChem CID | 176933645 |
| Molecular Formula | C11H21F2N |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | (4S)-1-butan-2-yl-4-ethyl-3,3-difluoropiperidine |
| SMILES | CCC(C)N1CC[C@H](CC)C(F)(F)C1 |
| InChI | InChI=1S/C11H21F2N/c1-4-9(3)14-7-6-10(5-2)11(12,13)8-14/h9-10H,4-8H2,1-3H3/t9?,10-/m0/s1 |
| InChIKey | RHEMKROTNVVUAV-AXDSSHIGSA-N |
| XLogP | 3.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |