C10H19F2N — CID 157352955
(4S)-4-ethyl-3,3-difluoro-1-propan-2-ylpiperidine (PubChem CID 157352955) has the molecular formula C10H19F2N and a molecular weight of 191.26 g/mol. Its IUPAC name is (4S)-4-ethyl-3,3-difluoro-1-propan-2-ylpiperidine.
| Compound Name | (4S)-4-ethyl-3,3-difluoro-1-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 157352955 |
| Molecular Formula | C10H19F2N |
| Molecular Weight | 191.26 g/mol |
| Exact Mass | 191.15 |
| IUPAC Name | (4S)-4-ethyl-3,3-difluoro-1-propan-2-ylpiperidine |
| SMILES | CC[C@H]1CCN(C(C)C)CC1(F)F |
| InChI | InChI=1S/C10H19F2N/c1-4-9-5-6-13(8(2)3)7-10(9,11)12/h8-9H,4-7H2,1-3H3/t9-/m0/s1 |
| InChIKey | XYZQQUOZZDDARH-VIFPVBQESA-N |
| XLogP | 2.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |