About 5-methyl-1,1-dioxothieno[2,3-c]azepin-5-amine
5-methyl-1,1-dioxothieno[2,3-c]azepin-5-amine (PubChem CID 152807982) has the molecular formula C9H10N2O2S
and a molecular weight of 210.26 g/mol. Its IUPAC name is 5-methyl-1,1-dioxothieno[2,3-c]azepin-5-amine.
Molecular Properties
| Compound Name | 5-methyl-1,1-dioxothieno[2,3-c]azepin-5-amine |
| PubChem CID | 152807982 |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 5-methyl-1,1-dioxothieno[2,3-c]azepin-5-amine |
| SMILES | CC1(N)C=NC=C2C(=C1)C=CS2(=O)=O |
| InChI | InChI=1S/C9H10N2O2S/c1-9(10)4-7-2-3-14(12,13)8(7)5-11-6-9/h2-6H,10H2,1H3 |
| InChIKey | SPWJURVTDDWCPB-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-1,1-dioxothieno[2,3-c]azepin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1,1-dioxothieno[2,3-c]azepin-5-amine?
The IUPAC name of 5-methyl-1,1-dioxothieno[2,3-c]azepin-5-amine (CID 152807982) is 5-methyl-1,1-dioxothieno[2,3-c]azepin-5-amine.
What is the SMILES notation for 5-methyl-1,1-dioxothieno[2,3-c]azepin-5-amine?
The canonical SMILES for 5-methyl-1,1-dioxothieno[2,3-c]azepin-5-amine is CC1(N)C=NC=C2C(=C1)C=CS2(=O)=O.
What is the InChIKey of 5-methyl-1,1-dioxothieno[2,3-c]azepin-5-amine?
The InChIKey is SPWJURVTDDWCPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2S/c1-9(10)4-7-2-3-14(12,13)8(7)5-11-6-9/h2-6H,10H2,1H3.
What are the key properties of 5-methyl-1,1-dioxothieno[2,3-c]azepin-5-amine?
5-methyl-1,1-dioxothieno[2,3-c]azepin-5-amine has a molecular weight of 210.26 g/mol, XLogP of 0.50, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1,1-dioxothieno[2,3-c]azepin-5-amine is sourced from PubChem (CID 152807982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).