C10H11NO2S — CID 143253572
5,5-dimethylthieno[2,3-c]azepine 1,1-dioxide (PubChem CID 143253572) has the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. Its IUPAC name is 5,5-dimethylthieno[2,3-c]azepine 1,1-dioxide.
| Compound Name | 5,5-dimethylthieno[2,3-c]azepine 1,1-dioxide |
|---|---|
| PubChem CID | 143253572 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 5,5-dimethylthieno[2,3-c]azepine 1,1-dioxide |
| SMILES | CC1(C)C=NC=C2C(=C1)C=CS2(=O)=O |
| InChI | InChI=1S/C10H11NO2S/c1-10(2)5-8-3-4-14(12,13)9(8)6-11-7-10/h3-7H,1-2H3 |
| InChIKey | VKTPOXKPWSMCRN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |