C12H17NS — CID 143335457
5,5-dimethylthieno[2,3-c]azepine;ethane (PubChem CID 143335457) has the molecular formula C12H17NS and a molecular weight of 207.34 g/mol. Its IUPAC name is 5,5-dimethylthieno[2,3-c]azepine;ethane.
| Compound Name | 5,5-dimethylthieno[2,3-c]azepine;ethane |
|---|---|
| PubChem CID | 143335457 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 5,5-dimethylthieno[2,3-c]azepine;ethane |
| SMILES | CC.CC1(C)C=NC=c2sccc2=C1 |
| InChI | InChI=1S/C10H11NS.C2H6/c1-10(2)5-8-3-4-12-9(8)6-11-7-10;1-2/h3-7H,1-2H3;1-2H3 |
| InChIKey | DKRFXESVBHDIOJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |