C25H25ClN2O3S — CID 152814620
[5-[(4-chlorophenyl)methylsulfonyl]-2-methylphenyl]-(4-phenylpiperazin-1-yl)methanone (PubChem CID 152814620) has the molecular formula C25H25ClN2O3S and a molecular weight of 469.01 g/mol. Its IUPAC name is [5-[(4-chlorophenyl)methylsulfonyl]-2-methylphenyl]-(4-phenylpiperazin-1-yl)methanone.
| Compound Name | [5-[(4-chlorophenyl)methylsulfonyl]-2-methylphenyl]-(4-phenylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 152814620 |
| Molecular Formula | C25H25ClN2O3S |
| Molecular Weight | 469.01 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | [5-[(4-chlorophenyl)methylsulfonyl]-2-methylphenyl]-(4-phenylpiperazin-1-yl)methanone |
| SMILES | Cc1ccc(S(=O)(=O)Cc2ccc(Cl)cc2)cc1C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H25ClN2O3S/c1-19-7-12-23(32(30,31)18-20-8-10-21(26)11-9-20)17-24(19)25(29)28-15-13-27(14-16-28)22-5-3-2-4-6-22/h2-12,17H,13-16,18H2,1H3 |
| InChIKey | SSDAYALBLDXPSE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.01 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |