C16H17FN4O2S — CID 152824385
6-fluoro-7-isocyano-4-[3-(methylsulfonylmethyl)piperidin-1-yl]quinazoline (PubChem CID 152824385) has the molecular formula C16H17FN4O2S and a molecular weight of 348.40 g/mol. Its IUPAC name is 6-fluoro-7-isocyano-4-[3-(methylsulfonylmethyl)piperidin-1-yl]quinazoline.
| Compound Name | 6-fluoro-7-isocyano-4-[3-(methylsulfonylmethyl)piperidin-1-yl]quinazoline |
|---|---|
| PubChem CID | 152824385 |
| Molecular Formula | C16H17FN4O2S |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 6-fluoro-7-isocyano-4-[3-(methylsulfonylmethyl)piperidin-1-yl]quinazoline |
| SMILES | [C-]#[N+]c1cc2ncnc(N3CCCC(CS(C)(=O)=O)C3)c2cc1F |
| InChI | InChI=1S/C16H17FN4O2S/c1-18-15-7-14-12(6-13(15)17)16(20-10-19-14)21-5-3-4-11(8-21)9-24(2,22)23/h6-7,10-11H,3-5,8-9H2,2H3 |
| InChIKey | SUNPDCJLBAGVNA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 67.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|