C23H31N3O4 — CID 152831744
2-aminoethyl 5-ethoxy-4-(2-methoxy-4-methylphenyl)-2,8-dimethyl-1,4,5,6-tetrahydro-1,6-naphthyridine-3-carboxylate (PubChem CID 152831744) has the molecular formula C23H31N3O4 and a molecular weight of 413.52 g/mol. Its IUPAC name is 2-aminoethyl 5-ethoxy-4-(2-methoxy-4-methylphenyl)-2,8-dimethyl-1,4,5,6-tetrahydro-1,6-naphthyridine-3-carboxylate.
| Compound Name | 2-aminoethyl 5-ethoxy-4-(2-methoxy-4-methylphenyl)-2,8-dimethyl-1,4,5,6-tetrahydro-1,6-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 152831744 |
| Molecular Formula | C23H31N3O4 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 2-aminoethyl 5-ethoxy-4-(2-methoxy-4-methylphenyl)-2,8-dimethyl-1,4,5,6-tetrahydro-1,6-naphthyridine-3-carboxylate |
| SMILES | CCOC1NC=C(C)C2=C1C(c1ccc(C)cc1OC)C(C(=O)OCCN)=C(C)N2 |
| InChI | InChI=1S/C23H31N3O4/c1-6-29-22-20-19(16-8-7-13(2)11-17(16)28-5)18(23(27)30-10-9-24)15(4)26-21(20)14(3)12-25-22/h7-8,11-12,19,22,25-26H,6,9-10,24H2,1-5H3 |
| InChIKey | SWIOPMFMIVHQEX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |