C23H28N4O4 — CID 146642322
2-cyanoethyl 4-(4-amino-2-methoxyphenyl)-5-ethoxy-2,8-dimethyl-1,4,5,6-tetrahydro-1,6-naphthyridine-3-carboxylate (PubChem CID 146642322) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is 2-cyanoethyl 4-(4-amino-2-methoxyphenyl)-5-ethoxy-2,8-dimethyl-1,4,5,6-tetrahydro-1,6-naphthyridine-3-carboxylate.
| Compound Name | 2-cyanoethyl 4-(4-amino-2-methoxyphenyl)-5-ethoxy-2,8-dimethyl-1,4,5,6-tetrahydro-1,6-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 146642322 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 2-cyanoethyl 4-(4-amino-2-methoxyphenyl)-5-ethoxy-2,8-dimethyl-1,4,5,6-tetrahydro-1,6-naphthyridine-3-carboxylate |
| SMILES | CCOC1NC=C(C)C2=C1C(c1ccc(N)cc1OC)C(C(=O)OCCC#N)=C(C)N2 |
| InChI | InChI=1S/C23H28N4O4/c1-5-30-22-20-19(16-8-7-15(25)11-17(16)29-4)18(23(28)31-10-6-9-24)14(3)27-21(20)13(2)12-26-22/h7-8,11-12,19,22,26-27H,5-6,10,25H2,1-4H3 |
| InChIKey | NQNNWFNUTBYHNE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 118.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|