C22H26ClNO4S — CID 152840571
1-[[2-(2-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfonyl]-5-(cyclohexen-1-yl)pentan-2-one (PubChem CID 152840571) has the molecular formula C22H26ClNO4S and a molecular weight of 435.97 g/mol. Its IUPAC name is 1-[[2-(2-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfonyl]-5-(cyclohexen-1-yl)pentan-2-one.
| Compound Name | 1-[[2-(2-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfonyl]-5-(cyclohexen-1-yl)pentan-2-one |
|---|---|
| PubChem CID | 152840571 |
| Molecular Formula | C22H26ClNO4S |
| Molecular Weight | 435.97 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 1-[[2-(2-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfonyl]-5-(cyclohexen-1-yl)pentan-2-one |
| SMILES | Cc1oc(-c2ccccc2Cl)nc1CS(=O)(=O)CC(=O)CCCC1=CCCCC1 |
| InChI | InChI=1S/C22H26ClNO4S/c1-16-21(24-22(28-16)19-12-5-6-13-20(19)23)15-29(26,27)14-18(25)11-7-10-17-8-3-2-4-9-17/h5-6,8,12-13H,2-4,7,9-11,14-15H2,1H3 |
| InChIKey | SYQOWRAFYLWAPT-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 77.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.97 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|