C18H22ClNO5S — CID 160669045
1-[[2-(2-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfonyl]-6-methoxyhexan-2-one (PubChem CID 160669045) has the molecular formula C18H22ClNO5S and a molecular weight of 399.90 g/mol. Its IUPAC name is 1-[[2-(2-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfonyl]-6-methoxyhexan-2-one.
| Compound Name | 1-[[2-(2-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfonyl]-6-methoxyhexan-2-one |
|---|---|
| PubChem CID | 160669045 |
| Molecular Formula | C18H22ClNO5S |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 1-[[2-(2-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfonyl]-6-methoxyhexan-2-one |
| SMILES | COCCCCC(=O)CS(=O)(=O)Cc1nc(-c2ccccc2Cl)oc1C |
| InChI | InChI=1S/C18H22ClNO5S/c1-13-17(20-18(25-13)15-8-3-4-9-16(15)19)12-26(22,23)11-14(21)7-5-6-10-24-2/h3-4,8-9H,5-7,10-12H2,1-2H3 |
| InChIKey | RMRMEDAJVVHXTP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 86.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|