C26H40N2O4S — CID 159314908
6-[bis(2-methylpropyl)amino]-1-[[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methylsulfonyl]hexan-2-one (PubChem CID 159314908) has the molecular formula C26H40N2O4S and a molecular weight of 476.68 g/mol. Its IUPAC name is 6-[bis(2-methylpropyl)amino]-1-[[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methylsulfonyl]hexan-2-one.
| Compound Name | 6-[bis(2-methylpropyl)amino]-1-[[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methylsulfonyl]hexan-2-one |
|---|---|
| PubChem CID | 159314908 |
| Molecular Formula | C26H40N2O4S |
| Molecular Weight | 476.68 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | 6-[bis(2-methylpropyl)amino]-1-[[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methylsulfonyl]hexan-2-one |
| SMILES | Cc1ccc(-c2nc(CS(=O)(=O)CC(=O)CCCCN(CC(C)C)CC(C)C)c(C)o2)cc1 |
| InChI | InChI=1S/C26H40N2O4S/c1-19(2)15-28(16-20(3)4)14-8-7-9-24(29)17-33(30,31)18-25-22(6)32-26(27-25)23-12-10-21(5)11-13-23/h10-13,19-20H,7-9,14-18H2,1-6H3 |
| InChIKey | LCZYXZQQOWCTHT-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 80.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.68 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|