C25H39N3O5S — CID 46255303
N-[3-[bis(2-methylpropyl)amino]propyl]-2-[[2-(3-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfonyl]acetamide (PubChem CID 46255303) has the molecular formula C25H39N3O5S and a molecular weight of 493.67 g/mol. Its IUPAC name is N-[3-[bis(2-methylpropyl)amino]propyl]-2-[[2-(3-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfonyl]acetamide.
| Compound Name | N-[3-[bis(2-methylpropyl)amino]propyl]-2-[[2-(3-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfonyl]acetamide |
|---|---|
| PubChem CID | 46255303 |
| Molecular Formula | C25H39N3O5S |
| Molecular Weight | 493.67 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | N-[3-[bis(2-methylpropyl)amino]propyl]-2-[[2-(3-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfonyl]acetamide |
| SMILES | COc1cccc(-c2nc(CS(=O)(=O)CC(=O)NCCCN(CC(C)C)CC(C)C)c(C)o2)c1 |
| InChI | InChI=1S/C25H39N3O5S/c1-18(2)14-28(15-19(3)4)12-8-11-26-24(29)17-34(30,31)16-23-20(5)33-25(27-23)21-9-7-10-22(13-21)32-6/h7,9-10,13,18-19H,8,11-12,14-17H2,1-6H3,(H,26,29) |
| InChIKey | RCQOVHZKQJGEPV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.67 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|