C20H28N2O5S — CID 20860662
2-[[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methylsulfonyl]-N-(3-propan-2-yloxypropyl)acetamide (PubChem CID 20860662) has the molecular formula C20H28N2O5S and a molecular weight of 408.52 g/mol. Its IUPAC name is 2-[[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methylsulfonyl]-N-(3-propan-2-yloxypropyl)acetamide.
| Compound Name | 2-[[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methylsulfonyl]-N-(3-propan-2-yloxypropyl)acetamide |
|---|---|
| PubChem CID | 20860662 |
| Molecular Formula | C20H28N2O5S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 2-[[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methylsulfonyl]-N-(3-propan-2-yloxypropyl)acetamide |
| SMILES | Cc1ccc(-c2nc(CS(=O)(=O)CC(=O)NCCCOC(C)C)c(C)o2)cc1 |
| InChI | InChI=1S/C20H28N2O5S/c1-14(2)26-11-5-10-21-19(23)13-28(24,25)12-18-16(4)27-20(22-18)17-8-6-15(3)7-9-17/h6-9,14H,5,10-13H2,1-4H3,(H,21,23) |
| InChIKey | AUQFOEXWCBHVMM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|