C20H28N2O4S2 — CID 20860680
2-[[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methylsulfonyl]-N-(3-propylsulfanylpropyl)acetamide (PubChem CID 20860680) has the molecular formula C20H28N2O4S2 and a molecular weight of 424.59 g/mol. Its IUPAC name is 2-[[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methylsulfonyl]-N-(3-propylsulfanylpropyl)acetamide.
| Compound Name | 2-[[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methylsulfonyl]-N-(3-propylsulfanylpropyl)acetamide |
|---|---|
| PubChem CID | 20860680 |
| Molecular Formula | C20H28N2O4S2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 2-[[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methylsulfonyl]-N-(3-propylsulfanylpropyl)acetamide |
| SMILES | CCCSCCCNC(=O)CS(=O)(=O)Cc1nc(-c2ccc(C)cc2)oc1C |
| InChI | InChI=1S/C20H28N2O4S2/c1-4-11-27-12-5-10-21-19(23)14-28(24,25)13-18-16(3)26-20(22-18)17-8-6-15(2)7-9-17/h6-9H,4-5,10-14H2,1-3H3,(H,21,23) |
| InChIKey | SOVVAVFZYSQFHX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|